For research use only. Not for therapeutic Use.
AZD0095（Cat No.:I042302）is a selective small molecule inhibitor developed by AstraZeneca, designed to target and inhibit the protein kinase GSK-3β (glycogen synthase kinase 3 beta). GSK-3β plays a key role in regulating various cellular processes, including cell survival, metabolism, and inflammation. By inhibiting GSK-3β, AZD0095 aims to modulate pathways involved in neurodegenerative diseases, such as Alzheimer’s disease, and potentially in cancers. In preclinical studies, AZD0095 has demonstrated the ability to reduce neuroinflammation and promote neuronal health, making it a promising candidate for the treatment of central nervous system disorders.
| Catalog Number | I042302 |
| CAS Number | 2750001-23-9 |
| Synonyms | 4-[[6-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]pyridazin-3-yl]methyl]morpholine |
| Molecular Formula | C27H32N8O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[[6-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]pyridazin-3-yl]methyl]morpholine |
| InChI | InChI=1S/C27H32N8O2/c1-18-26(19(2)35-27(28-18)29-20(3)32-35)37-24-10-11-34(17-24)23-7-4-21(5-8-23)25-9-6-22(30-31-25)16-33-12-14-36-15-13-33/h4-9,24H,10-17H2,1-3H3/t24-/m1/s1 |
| InChIKey | PHDAGSZQGNWGFE-XMMPIXPASA-N |
| SMILES | CC1=C(C(=NC2=NC(=NN12)C)C)O[C@@H]3CCN(C3)C4=CC=C(C=C4)C5=NN=C(C=C5)CN6CCOCC6 |
