For research use only. Not for therapeutic Use.
AZD1208(Cat No.:I000752) is a high-purity investigational compound essential for advanced pharmaceutical research and oncology studies. This potent and selective inhibitor of the Pim kinase family is crucial for investigating the pharmacokinetics, metabolism, and mechanisms of action in cancer therapies. AZD1208 plays a significant role in studying the inhibition of tumor growth and survival pathways. Widely used in research involving hematologic malignancies, solid tumors, and combination therapy strategies, AZD1208 integrates seamlessly into various experimental protocols, providing a robust and dependable solution for high-precision scientific investigations in drug development.
CAS Number | 1204144-28-4 |
Synonyms | (5E)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-phenylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
Molecular Formula | C₂₁H₂₁N₃O₂S |
Purity | ≥95% |
Target | Autophagy |
Solubility | DMSO: ≥ 28.5 mg/mL |
Storage | Store at -20°C |
IC50 | < 5 nM |
IUPAC Name | (5Z)-5-[[2-[(3R)-3-aminopiperidin-1-yl]-3-phenylphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
InChI | InChI=1S/C21H21N3O2S/c22-16-9-5-11-24(13-16)19-15(12-18-20(25)23-21(26)27-18)8-4-10-17(19)14-6-2-1-3-7-14/h1-4,6-8,10,12,16H,5,9,11,13,22H2,(H,23,25,26)/b18-12-/t16-/m1/s1 |
InChIKey | MCUJKPPARUPFJM-UWCCDQBKSA-N |
SMILES | C1C[C@H](CN(C1)C2=C(C=CC=C2C3=CC=CC=C3)/C=C\4/C(=O)NC(=O)S4)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |