For research use only. Not for therapeutic Use.
AZD3147（Cat No.:I003026）is an investigational small molecule being studied for its potential therapeutic applications, particularly in the treatment of cancer. It is designed to inhibit specific enzymes involved in the regulation of key molecular pathways, such as those responsible for tumor growth, metastasis, and resistance to treatment. AZD3147 targets the fibroblast growth factor receptor (FGFR) signaling pathway, which plays a role in cancer cell proliferation and survival. Ongoing research is focused on assessing its efficacy and safety, particularly in cancers with FGFR mutations or alterations, potentially offering a new treatment option for patients.
| CAS Number | 1101810-02-9 |
| Synonyms | 1-[4-[4-(1-cyclopropylsulfonylcyclopropyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea |
| Molecular Formula | C24H31N5O4S2 |
| Purity | ≥95% |
| IUPAC Name | 1-[4-[4-(1-cyclopropylsulfonylcyclopropyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea |
| InChI | InChI=1S/C24H31N5O4S2/c1-16-15-33-13-11-29(16)21-14-20(24(8-9-24)35(31,32)19-6-7-19)27-22(28-21)17-2-4-18(5-3-17)26-23(34)25-10-12-30/h2-5,14,16,19,30H,6-13,15H2,1H3,(H2,25,26,34)/t16-/m0/s1 |
| InChIKey | JWGVUDPAMQEIJU-INIZCTEOSA-N |
| SMILES | C[C@H]1COCCN1C2=NC(=NC(=C2)C3(CC3)S(=O)(=O)C4CC4)C5=CC=C(C=C5)NC(=S)NCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
