For research use only. Not for therapeutic Use.
AZD3514 is an experimental drug developed as a selective androgen receptor (AR) modulator and antagonist. It was primarily investigated for its potential use in treating castration-resistant prostate cancer (CRPC). AZD3514 works by inhibiting the expression of androgen receptor-regulated genes and promoting the degradation of androgen receptors in cancer cells. This dual mechanism disrupts the signaling pathways essential for the growth and survival of prostate cancer cells that are resistant to standard hormone therapies. Although promising in early studies, the development of AZD3514 has been discontinued due to challenges in achieving a favorable balance between efficacy and safety.
| Catalog Number | I000960 |
| CAS Number | 1240299-33-5 |
| Synonyms | AZD-3514;AZD 3514 |
| Molecular Formula | C25H32F3N7O2 |
| Purity | ≥95% |
| Target | Androgen Receptor |
| Solubility | DMSO 100 mg/ml |
| Storage | -20°C |
| IC50 | 2.2 uM (Ki) |
| InChI | InChI=1S/C25H32F3N7O2/c1-18(36)33-14-12-32(13-15-33)16-17-37-21-4-2-19(3-5-21)20-8-10-34(11-9-20)23-7-6-22-29-30-24(25(26,27)28)35(22)31-23/h2-5,20H,6-17H2,1H3 |
| InChIKey | JMEYDSHPKCSIJC-UHFFFAOYSA-N |
| SMILES | CC(N1CCN(CCOC2=CC=C(C3CCN(C4=NN5C(CC4)=NN=C5C(F)(F)F)CC3)C=C2)CC1)=O |
