For research use only. Not for therapeutic Use.
AZD3965(Cat No.:I001736) is a novel, small molecule inhibitor specifically targeting the monocarboxylate transporter 1 (MCT1). By inhibiting MCT1, AZD3965 disrupts the lactate transport and metabolic communication within tumor cells, which is crucial for their growth and survival, particularly in highly glycolytic environments. This mechanism makes it a promising therapeutic candidate for treating various cancers, including lymphomas and solid tumors. Currently under clinical investigation, AZD3965 aims to exploit the metabolic vulnerabilities of cancer cells, potentially leading to more effective cancer therapies with reduced side effects.
Catalog Number | I001736 |
CAS Number | 1448671-31-5 |
Synonyms | 5-[[(4S)-4-hydroxy-4-methyl-2-isoxazolidinyl]carbonyl]-3-methyl-1-(1-methylethyl)-6-[[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]-thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
Molecular Formula | C21H24F3N5O5S |
Purity | ≥95% |
Target | Monocarboxylate Transporter |
Solubility | DMSO: ≥ 36 mg/mL |
Storage | Store at -20°C |
IC50 | 1.6 nM(Ki) |
IUPAC Name | 5-[(4S)-4-hydroxy-4-methyl-1,2-oxazolidine-2-carbonyl]-3-methyl-6-[[5-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]-1-propan-2-ylthieno[2,3-d]pyrimidine-2,4-dione |
InChI | InChI=1S/C21H24F3N5O5S/c1-9(2)29-18-14(16(30)27(5)19(29)32)13(17(31)28-7-20(4,33)8-34-28)12(35-18)6-11-10(3)25-26-15(11)21(22,23)24/h9,33H,6-8H2,1-5H3,(H,25,26)/t20-/m0/s1 |
InChIKey | PRNXOFBDXNTIFG-FQEVSTJZSA-N |
SMILES | CC1=C(C(=NN1)C(F)(F)F)CC2=C(C3=C(S2)N(C(=O)N(C3=O)C)C(C)C)C(=O)N4CC(CO4)(C)O |