For research use only. Not for therapeutic Use.
AZD5462（Cat No.:I042894）is an investigational small molecule inhibitor targeting the protein kinase Aurora B, which is involved in regulating cell division and maintaining chromosome stability. By inhibiting Aurora B, AZD5462 disrupts cell division, leading to the accumulation of defects in the cell cycle, triggering apoptosis, and preventing cancer cell proliferation. It is being studied for its potential in treating various types of cancer, particularly those with aberrant cell cycle regulation. Early clinical trials are evaluating its safety, efficacy, and potential as a targeted therapy for tumors resistant to conventional treatments.
| CAS Number | 2787501-83-9 |
| Synonyms | 4-[2-fluoro-4-methoxy-5-[[(1S,2R,3S,4R)-3-[(1-methylcyclobutyl)methylcarbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]phenoxy]-1-methylcyclohexane-1-carboxylic acid |
| Molecular Formula | C30H41FN2O6 |
| Purity | ≥95% |
| IUPAC Name | 4-[2-fluoro-4-methoxy-5-[[(1S,2R,3S,4R)-3-[(1-methylcyclobutyl)methylcarbamoyl]-2-bicyclo[2.2.1]heptanyl]carbamoyl]phenoxy]-1-methylcyclohexane-1-carboxylic acid |
| InChI | InChI=1S/C30H41FN2O6/c1-29(9-4-10-29)16-32-27(35)24-17-5-6-18(13-17)25(24)33-26(34)20-14-23(21(31)15-22(20)38-3)39-19-7-11-30(2,12-8-19)28(36)37/h14-15,17-19,24-25H,4-13,16H2,1-3H3,(H,32,35)(H,33,34)(H,36,37)/t17-,18+,19?,24+,25-,30?/m1/s1 |
| InChIKey | LYUYYIGCZIZIGF-SRHODNEWSA-N |
| SMILES | CC1(CCC1)CNC(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2NC(=O)C4=CC(=C(C=C4OC)F)OC5CCC(CC5)(C)C(=O)O |
