For research use only. Not for therapeutic Use.
AZD5597(CAT: I003731) is a potent and selective inhibitor of cyclin-dependent kinases CDK1 and CDK2, key regulators of cell cycle progression. By targeting these kinases, AZD5597 effectively disrupts cell division, making it a valuable tool in cancer research and drug development. It has demonstrated strong antiproliferative activity in various tumor models, particularly in rapidly dividing cancer cells. AZD5597 is commonly used in preclinical studies to investigate cell cycle control, apoptosis induction, and combination therapy strategies. Its high specificity and bioactivity make it ideal for exploring targeted cancer therapies and understanding the molecular mechanisms driving tumor growth.
| CAS Number | 924641-59-8 |
| Synonyms | [4-[[5-fluoro-4-(2-methyl-3-propan-2-ylimidazol-4-yl)pyrimidin-2-yl]amino]phenyl]-[(3S)-3-(methylamino)pyrrolidin-1-yl]methanone |
| Molecular Formula | C23H28FN7O |
| Purity | ≥95% |
| IUPAC Name | [4-[[5-fluoro-4-(2-methyl-3-propan-2-ylimidazol-4-yl)pyrimidin-2-yl]amino]phenyl]-[(3S)-3-(methylamino)pyrrolidin-1-yl]methanone |
| InChI | InChI=1S/C23H28FN7O/c1-14(2)31-15(3)26-12-20(31)21-19(24)11-27-23(29-21)28-17-7-5-16(6-8-17)22(32)30-10-9-18(13-30)25-4/h5-8,11-12,14,18,25H,9-10,13H2,1-4H3,(H,27,28,29)/t18-/m0/s1 |
| InChIKey | NTSDIJMNXYJJNG-SFHVURJKSA-N |
| SMILES | CC1=NC=C(N1C(C)C)C2=NC(=NC=C2F)NC3=CC=C(C=C3)C(=O)N4CC[C@@H](C4)NC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
