For research use only. Not for therapeutic Use.
AZD7624（Cat No.:I014766） is a high-purity, investigational compound designed for advanced pharmaceutical research. As a potent inhaled p38 MAPK inhibitor, AZD7624 is being explored for its therapeutic potential in treating chronic obstructive pulmonary disease (COPD) and other inflammatory respiratory conditions. Its targeted action aims to reduce inflammation and improve lung function, making it a promising candidate in respiratory drug development. This compound is crucial for researchers focusing on respiratory disease mechanisms, anti-inflammatory drug efficacy, and novel therapeutic strategies, providing a robust and reliable tool for high-precision scientific investigations and clinical trials.
| Catalog Number | I014766 |
| CAS Number | 1095004-78-6 |
| Synonyms | AZD-7624; AZD 7624; AZD7624; |
| Molecular Formula | C27H30FN5O3 |
| Purity | ≥95% |
| Target | p38α MAPK |
| IUPAC Name | N-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide |
| InChI | InChI=1S/C27H30FN5O3/c1-17-21(28)15-18(25(34)31-19-7-8-19)16-22(17)33-13-11-30-24(26(33)35)32-27(9-10-27)20-5-3-4-6-23(20)36-14-12-29-2/h3-6,11,13,15-16,19,29H,7-10,12,14H2,1-2H3,(H,30,32)(H,31,34) |
| InChIKey | NNKPHNTWNILINE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1F)C(=O)NC2CC2)N3C=CN=C(C3=O)NC4(CC4)C5=CC=CC=C5OCCNC |
