For research use only. Not for therapeutic Use.
AZD8797(CAT: I013659) is a selective small-molecule antagonist of the chemokine receptor CX3CR1, which plays a key role in inflammatory processes and the recruitment of immune cells to sites of inflammation. By blocking the interaction between CX3CR1 and its ligand, fractalkine, AZD8797 is designed to modulate immune responses, making it a potential therapeutic candidate for treating inflammatory and autoimmune diseases, as well as certain neurodegenerative conditions. Preclinical studies have shown that AZD8797 can reduce inflammation and protect against tissue damage in models of diseases such as multiple sclerosis and rheumatoid arthritis. Its targeted mechanism of action and selectivity make it an attractive candidate for further research in inflammatory disease therapies.
| Catalog Number | I013659 |
| CAS Number | 911715-90-7 |
| Synonyms | (2R)-2-[[2-amino-5-[(1S)-1-phenylethyl]sulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]amino]-4-methylpentan-1-ol |
| Molecular Formula | C19H25N5OS2 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[[2-amino-5-[(1S)-1-phenylethyl]sulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]amino]-4-methylpentan-1-ol |
| InChI | InChI=1S/C19H25N5OS2/c1-11(2)9-14(10-25)21-16-15-17(22-18(20)27-15)24-19(23-16)26-12(3)13-7-5-4-6-8-13/h4-8,11-12,14,25H,9-10H2,1-3H3,(H3,20,21,22,23,24)/t12-,14+/m0/s1 |
| InChIKey | ZMQSLMZOWVGBSM-GXTWGEPZSA-N |
| SMILES | CC(C)CC(CO)NC1=NC(=NC2=C1SC(=N2)N)SC(C)C3=CC=CC=C3 |
