For research use only. Not for therapeutic Use.
Azido-PEG1-CH2COO-Cl(Cat No.:I015518)is a chemical compound used in biochemical research, primarily in the context of conjugation and labeling studies. It consists of a polyethylene glycol (PEG) chain with an azido group (-N3) at one end, a carboxylate group (-COO-) at the other, and a reactive chloride (Cl) moiety. The azido group allows for click chemistry reactions, facilitating the attachment of this compound to other biomolecules or surfaces. This makes it useful for creating targeted drug delivery systems, bio-conjugation, or surface modifications in molecular biology, materials science, and pharmaceutical research.
CAS Number | 79598-49-5 |
Molecular Formula | C₄H₆ClN₃O₂ |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | 2-(2-azidoethoxy)acetyl chloride |
InChI | InChI=1S/C4H6ClN3O2/c5-4(9)3-10-2-1-7-8-6/h1-3H2 |
InChIKey | FSOUWBZLOHCVTL-UHFFFAOYSA-N |
SMILES | C(COCC(=O)Cl)N=[N+]=[N-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |