For research use only. Not for therapeutic Use.
Azido-PEG2-CH2COOH (CHA)(Cat No.:I042682)is a compound that combines a polyethylene glycol (PEG) linker with an azido group and a carboxylic acid (COOH) functionality. The azido group enables the compound to be used in click chemistry reactions, which are useful for conjugating molecules, labeling, or modifying surfaces. The PEG linker provides water solubility and biocompatibility, while the carboxylic acid group can facilitate further chemical modifications or interactions with proteins or other biomolecules. CHA is commonly employed in bioconjugation, drug delivery, and surface functionalization applications in research and development.
CAS Number | 2098500-94-6 |
Synonyms | 2-[2-(2-azidoethoxy)ethoxy]acetic acid;methylcyclohexane |
Molecular Formula | C12H24N4O4 |
Purity | ≥95% |
IUPAC Name | 2-[2-(2-azidoethoxy)ethoxy]acetic acid;cyclohexanamine |
InChI | InChI=1S/C6H11N3O4.C6H13N/c7-9-8-1-2-12-3-4-13-5-6(10)11;7-6-4-2-1-3-5-6/h1-5H2,(H,10,11);6H,1-5,7H2 |
InChIKey | CVGMGYQHORMPPJ-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)N.C(COCCOCC(=O)O)N=[N+]=[N-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |