For research use only. Not for therapeutic Use.
Azido-PEG4-PFP ester(Cat No.:R037883), is a chemical compound used in bioconjugation and crosslinking applications. It belongs to the class of PEGylated compounds, where PEG (polyethylene glycol) is attached to a functional group, in this case, an azido group. The PFP (pentafluorophenyl) ester facilitates the conjugation process. Azido-PEG4-PFP ester is often utilized in biochemistry and drug delivery research to modify biomolecules, such as proteins and peptides, for various applications, including targeted drug delivery and protein engineering.
CAS Number | 1353012-00-6 |
Molecular Formula | C17H20F5N3O6 |
Purity | ≥95% |
Target | ADC Linker |
Storage | -20°C |
IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
InChI | InChI=1S/C17H20F5N3O6/c18-12-13(19)15(21)17(16(22)14(12)20)31-11(26)1-3-27-5-7-29-9-10-30-8-6-28-4-2-24-25-23/h1-10H2 |
InChIKey | QSIFGTAWLLFXPY-UHFFFAOYSA-N |
SMILES | C(COCCOCCOCCOCCN=[N+]=[N-])C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |