For research use only. Not for therapeutic Use.
Azido-PEG4-PFP ester（Cat No.:R037883）, is a chemical compound used in bioconjugation and crosslinking applications. It belongs to the class of PEGylated compounds, where PEG (polyethylene glycol) is attached to a functional group, in this case, an azido group. The PFP (pentafluorophenyl) ester facilitates the conjugation process. Azido-PEG4-PFP ester is often utilized in biochemistry and drug delivery research to modify biomolecules, such as proteins and peptides, for various applications, including targeted drug delivery and protein engineering.
| Catalog Number | R037883 |
| CAS Number | 1353012-00-6 |
| Molecular Formula | C17H20F5N3O6 |
| Purity | ≥95% |
| Target | ADC Linker |
| Storage | -20°C |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C17H20F5N3O6/c18-12-13(19)15(21)17(16(22)14(12)20)31-11(26)1-3-27-5-7-29-9-10-30-8-6-28-4-2-24-25-23/h1-10H2 |
| InChIKey | QSIFGTAWLLFXPY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCN=[N+]=[N-])C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F |
