For research use only. Not for therapeutic Use.
Azido-PEG8-NHS ester(Cat No.:I017035) is a linker molecule with 8 units of PEG that is used to conjugate drugs to antibodies to create antibody-drug conjugates (ADCs). The azide functional group allows for bioorthogonal conjugation reactions, while the cleavable ester bond enables the release of the drug payload once the ADC is internalized into the target cell. Additionally, Azido-PEG8-NHS ester is also a PROTAC linker that can be used to synthesize PROTAC molecules, a type of targeted protein degradation agent that recruits E3 ligases to degrade specific proteins of interest.
CAS Number | 1204834-00-3 |
Molecular Formula | C₂₃H₄₀N₄O₁₂ |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
InChI | InChI=1S/C23H40N4O12/c24-26-25-4-6-32-8-10-34-12-14-36-16-18-38-20-19-37-17-15-35-13-11-33-9-7-31-5-3-23(30)39-27-21(28)1-2-22(27)29/h1-20H2 |
InChIKey | AZXJVYAMFTUKFC-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
Reference | [1]. Mahendra Persaud Deonarain, et al. Biological materials and uses thereof. WO2016046574A1.<br>[2]. Rong Yuan, et al. Viruslike Element-Tagged Nanoparticle Inductively Coupled Plasma Mass Spectrometry Signal Multiplier: Membrane Biomarker Mediated Cell Counting. Analytical Chemistry (Washington, DC, United States) (2019), 91(8), 4948-4952. |