For research use only. Not for therapeutic Use.
Azilsartan(Cat No.:A000335)is an angiotensin II receptor blocker (ARB) used to treat hypertension. By selectively blocking the AT1 receptor, it prevents the action of angiotensin II, a hormone that causes blood vessels to constrict and raises blood pressure. Azilsartan helps relax blood vessels, lowering blood pressure and reducing the risk of cardiovascular events such as heart attack and stroke. It is known for its potency and long-lasting effects, providing sustained blood pressure control. Azilsartan is well-tolerated, with fewer side effects compared to other antihypertensive agents, making it a valuable option in hypertension management.
| CAS Number | 147403-03-0 |
| Synonyms | 147403-03-0; TAK-536; TAK 536; UNII-F9NUX55P23; CHEMBL57242 |
| Molecular Formula | C25H20N4O5 |
| Purity | ≥95% |
| Target | NF-κB |
| Solubility | >17mg/mL in DMSO |
| IUPAC Name | 2-ethoxy-3-[[4-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
| InChI | InChI=1S/C25H20N4O5/c1-2-33-24-26-20-9-5-8-19(23(30)31)21(20)29(24)14-15-10-12-16(13-11-15)17-6-3-4-7-18(17)22-27-25(32)34-28-22/h3-13H,2,14H2,1H3,(H,30,31)(H,27,28,32) |
| InChIKey | KGSXMPPBFPAXLY-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C5=NOC(=O)N5)C(=O)O |
| Reference | 1: Hussain SA, Utba RM, Assumaidaee AM. Effects of Azilsartan, Aliskiren or their 2: Fujiwara N, Tanaka A, Kawaguchi A, Tago M, Oyama JI, Uchida Y, Matsunaga K, 3: Sukumaran V, Tsuchimochi H, Tatsumi E, Shirai M, Pearson JT. Azilsartan 4: Dudkowski C, Karim A, Zhao Z, Alonso AB, Garg D, Preston RA. Single-Center 5: Neutel JM, Cushman WC, Lloyd E, Barger B, Handley A. Comparison of long-term 6: Miyoshi T, Suetsuna R, Tokunaga N, Kusaka M, Tsuzaki R, Koten K, Kunihisa K, 7: Shiga Y, Miura SI, Motozato K, Norimatsu K, Yano M, Hitaka Y, Adachi S, Kuwano 8: Johnson W, White WB, Sica D, Bakris GL, Weber MA, Handley A, Perez A, Cao C, 9: Gao Q, Ou Z, Jiang T, Tian YY, Zhou JS, Wu L, Shi JQ, Zhang YD. Azilsartan 10: Hjermitslev M, Grimm DG, Wehland M, Simonsen U, Krüger M. Azilsartan |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |