For research use only. Not for therapeutic Use.
Azomycin(Cat No.:R006698), also known as 2-nitroimidazole, is a nitroimidazole compound recognized for its antimicrobial and antiparasitic properties. It works by generating reactive intermediates under anaerobic conditions, targeting and damaging DNA in microorganisms. Azomycin is notably effective against anaerobic bacteria and certain protozoa, making it a useful agent in treating infections in low-oxygen environments. Its unique action mechanism, which disrupts essential microbial processes, has also spurred interest in cancer research as a potential hypoxia marker in tumors, where it may help identify and target hypoxic cancer cells.
Catalog Number | R006698 |
CAS Number | 527-73-1 |
Synonyms | 2-Nitroimidazole; 2-Nitro-1H-imidazole; |
Molecular Formula | C3H3N3O2 |
Purity | ≥95% |
Target | Bacterial |
Storage | 3 years -20C powder |
IUPAC Name | 2-nitro-1H-imidazole |
InChI | InChI=1S/C3H3N3O2/c7-6(8)3-4-1-2-5-3/h1-2H,(H,4,5) |
InChIKey | YZEUHQHUFTYLPH-UHFFFAOYSA-N |
SMILES | C1=CN=C(N1)[N+](=O)[O-] |