For research use only. Not for therapeutic Use.
Azoxystrobin(Cat No.:R050662) is a fungicide belonging to the strobilurin group. Its mode of action involves being a broad-spectrum fungicide effective against various fungal pathogens that attack crops, particularly foliar diseases. Azoxystrobin works by inhibiting the respiration process in fungi, disrupting their energy production and ultimately leading to their death. This mechanism of action makes it an effective tool in protecting crops from fungal diseases and improving crop yields. It is commonly used in agriculture to control diseases in a wide range of crops, including cereals, fruits, vegetables, and turf.
CAS Number | 131860-33-8 |
Synonyms | (αE)-2-[[6-(2-Cyanophenoxy)-4-pyrimidinyl]oxy]-α-(methoxymethylene)benzeneacetic Acid Methyl Ester; Methyl (E)-2-[2-[6-(2-Cyanophenoxy)pyrimidin-4-yloxy]phenyl]-?3-methoxypropenoate; Abound; Amistar; Bankit; Cruiser Extreme; Dynasty; Heritage; Ortiva |
Molecular Formula | C22H17N3O5 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | methyl (E)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate |
InChI | InChI=1S/C22H17N3O5/c1-27-13-17(22(26)28-2)16-8-4-6-10-19(16)30-21-11-20(24-14-25-21)29-18-9-5-3-7-15(18)12-23/h3-11,13-14H,1-2H3/b17-13+ |
InChIKey | WFDXOXNFNRHQEC-GHRIWEEISA-N |
SMILES | CO/C=C(\C1=CC=CC=C1OC2=NC=NC(=C2)OC3=CC=CC=C3C#N)/C(=O)OC |