For research use only. Not for therapeutic Use.
Azulene（Cat No.:R020928）is a naturally occurring organic compound known for its vivid blue color and unique chemical structure featuring fused five- and seven-membered rings. It is widely studied for its anti-inflammatory, antioxidant, and soothing properties, making it a key ingredient in pharmaceutical and cosmetic formulations. Azulene exhibits notable UV-absorbing abilities and is used in skin care products to calm irritated skin and reduce redness. Its chemical stability and bioactive properties also make it a subject of interest in medicinal chemistry, particularly in exploring its potential therapeutic applications.
| Catalog Number | R020928 |
| CAS Number | 275-51-4 |
| Synonyms | Bicyclo[5.3.0]decapentaene; Cyclopentacycloheptene; NSC 89248 |
| Molecular Formula | C10H8 |
| Purity | ≥95% |
| Target | HIV |
| Storage | -20°C |
| IUPAC Name | azulene |
| InChI | InChI=1S/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
| InChIKey | CUFNKYGDVFVPHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=CC=C2C=C1 |
