For research use only. Not for therapeutic Use.
Azure B bromide is a cationic dye, closely related to methylene blue, primarily used in biological staining and histology. It is part of the thiazine dye family and is known for its affinity for nucleic acids, making it valuable in the staining of DNA and RNA in microscopy studies. Azure B bromide is used in applications such as Giemsa staining, where it helps visualize cellular structures like chromatin and organelles in blood smears and tissue samples. In addition to biological applications, Azure B bromide has been explored for its redox properties in biochemical research, particularly in studies involving oxidative stress.
CAS Number | 531-55-5 |
Synonyms | Azure I |
Molecular Formula | C15H16ClN3S |
Purity | ≥95% |
Target | Monoamine Oxidase |
Storage | RT |
IUPAC Name | dimethyl-[7-(methylamino)phenothiazin-3-ylidene]azanium;chloride |
InChI | InChI=1S/C15H15N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9H,1-3H3;1H |
InChIKey | DNDJEIWCTMMZBX-UHFFFAOYSA-N |
SMILES | CNC1=CC2=C(C=C1)N=C3C=CC(=[N+](C)C)C=C3S2.[Cl-] |