For research use only. Not for therapeutic Use.
B 220(CAT: M026911) is an antiviral agent that exhibits inhibitory effects against HSV-1 (Herpes Simplex Virus type 1), HSV-2 (Herpes Simplex Virus type 2), and human cytomegalovirus (CMV). This compound’s mode of action likely involves interfering with the replication and spread of these viruses, thus making it a promising candidate for antiviral therapies. Further research and testing are likely underway to explore its potential applications in treating viral infections caused by these viruses.
CAS Number | 112228-65-6 |
Molecular Formula | C20H22N4O |
Purity | ≥95% |
Target | HSV |
Storage | -20°C |
IUPAC Name | 6-[2-(dimethylamino)ethyl]-2,3-dimethylindolo[3,2-b]quinoxalin-9-ol |
InChI | InChI=1S/C20H22N4O/c1-12-9-16-17(10-13(12)2)22-20-19(21-16)15-11-14(25)5-6-18(15)24(20)8-7-23(3)4/h5-6,9-11,25H,7-8H2,1-4H3 |
InChIKey | XHSFKJPSEUMXJL-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1C)N=C3C(=N2)C4=C(N3CCN(C)C)C=CC(=C4)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |