For research use only. Not for therapeutic Use.
β-Endosulfan-d4(Cat No.:R069875) is a deuterated form of β-Endosulfan, containing four deuterium atoms, which enhances its detection and quantification in environmental and toxicological studies. This organochlorine pesticide is known for its role in agricultural pest control but raises concerns due to its persistence and toxicity. The deuteration of β-Endosulfan-d4 aids in tracing its environmental fate and studying its degradation pathways, crucial for assessing ecological risks and human health impacts. This compound is essential for developing more accurate and sensitive analytical methods for pesticide detection and monitoring in various ecosystems.
CAS Number | 203716-99-8 |
Molecular Formula | C9H6Cl6O3S |
Purity | ≥95% |
Storage | RT |
IUPAC Name | (1S,2R,8S,9R)-1,9,10,11,12,12-hexachloro-3,3,7,7-tetradeuterio-4,6-dioxa-5λ4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide |
InChI | InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2/t3-,4+,7-,8+,19?/i1D2,2D2 |
InChIKey | RDYMFSUJUZBWLH-WWUWEAHGSA-N |
SMILES | [2H]C1([C@@H]2[C@@H]([C@@]3(C(=C([C@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl)C(OS(=O)O1)([2H])[2H])[2H] |