For research use only. Not for therapeutic Use.
B02（Cat No.:I003899）is a selective inhibitor of the protein kinase CK2 (casein kinase 2), which is involved in regulating various cellular processes, including cell proliferation, apoptosis, and DNA repair. By inhibiting CK2, B02 disrupts signaling pathways that promote cancer cell survival and growth, making it a potential candidate for cancer therapy. Preclinical studies have demonstrated its efficacy in reducing tumor growth in various cancer models, including breast and prostate cancers. B02’s specificity for CK2 may help minimize off-target effects, providing a promising approach in the development of targeted cancer treatments.
| Catalog Number | I003899 |
| CAS Number | 1290541-46-6 |
| Synonyms | B02; B-02; B 02; RAD51-IN-02;3-Benzyl-2-[(E)-2-(3-pyridinyl)ethenyl]-4(3H)-quinazolinone |
| Molecular Formula | C22H17N3O |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 3-benzyl-2-[(E)-2-pyridin-3-ylethenyl]quinazolin-4-one |
| InChI | InChI=1S/C22H17N3O/c26-22-19-10-4-5-11-20(19)24-21(13-12-17-9-6-14-23-15-17)25(22)16-18-7-2-1-3-8-18/h1-15H,16H2/b13-12+ |
| InChIKey | GEKDQXSPTHHANP-OUKQBFOZSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NC3=CC=CC=C3C2=O)/C=C/C4=CN=CC=C4 |
| Reference | </br> 1: Alagpulinsa DA, Ayyadevara S, Shmookler Reis RJ. A Small-Molecule Inhibitor of RAD51 Reduces Homologous Recombination and Sensitizes Multiple Myeloma Cells to Doxorubicin. Front Oncol. 2014 Oct 30;4:289. doi: 10.3389/fonc.2014.00289. eCollection |
