For research use only. Not for therapeutic Use.
BA-53038B（Cat No.:I019070）is a hepatitis B virus (HBV) core protein allosteric modulator (CpAM) that binds to the hydrophobic pocket (HAP) on the HBV core protein, influencing capsid assembly. It exhibits antiviral activity with an EC₅₀ value of 3.32 μM against HBV.Unlike typical CpAMs, BA-53038B induces the formation of morphologically normal empty capsids with slower electrophoretic mobility, suggesting a unique modulation mechanism. This distinct behavior positions BA-53038B as a promising candidate for chronic hepatitis B research, offering insights into novel therapeutic strategies targeting HBV capsid assembly.
| Catalog Number | I019070 |
| CAS Number | 2306195-65-1 |
| Molecular Formula | C₁₄H₁₆ClNO |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | N-(3-chlorophenyl)bicyclo[4.1.0]heptane-7-carboxamide |
| InChI | InChI=1S/C14H16ClNO/c15-9-4-3-5-10(8-9)16-14(17)13-11-6-1-2-7-12(11)13/h3-5,8,11-13H,1-2,6-7H2,(H,16,17) |
| InChIKey | ZLCICHYECNOTGG-UHFFFAOYSA-N |
| SMILES | C1CCC2C(C1)C2C(=O)NC3=CC(=CC=C3)Cl |
| Reference | [1]. Zhang X, et al. Discovery of Novel Hepatitis B Virus Nucleocapsid Assembly Inhibitors. ACS Infect Dis. 2019 May 10;5(5):759-768. |
