Baccatin III（Cat No.:R003450） is a natural compound found in the bark of the Pacific yew tree (Taxus brevifolia). It is a precursor in the semi-synthesis of paclitaxel, a chemotherapy medication used to treat various cancers. Baccatin III is converted into paclitaxel through a series of chemical reactions, making it a key intermediate in the production of this important anticancer drug. Baccatin III itself has been studied for its potential biological activities and may have anticancer properties. Research on baccatin III and its derivatives continues to explore its therapeutic potential and its role in the development of new cancer treatments.
| Catalog Number | R003450 |
| CAS Number | 27548-93-2 |
| Synonyms | (2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS)-6,12b-Bis(acetyloxy)-12-(benzoyloxy)-1,2a,3,4,4a,6,9,10,11,12,12a,12b-dodecahydro-4,9,11-trihydroxy-4a,8,13,13-tetramethyl-7,11-methano-5H-cyclodeca[3,4]benz[1,2-b]oxet-5-one; NSC 330753 |
| Molecular Formula | C31H38O11 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| InChI | InChI=1S/C31H38O11/c1-15-19(34)13-31(38)26(41-27(37)18-10-8-7-9-11-18)24-29(6,20(35)12-21-30(24,14-39-21)42-17(3)33)25(36)23(40-16(2)32)22(15)28(31,4)5/h7-11,19-21,23-24,26,34-35,38H,12-14H2,1-6H3/t19-,20-,21+,23+,24-,26-,29+,30-,31+/m0/s1 |
| InChIKey | OVMSOCFBDVBLFW-VHLOTGQHSA-N |
| SMILES | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)O)C)OC(=O)C |
