For research use only. Not for therapeutic Use.
Bacoside A is a key active compound found in Bacopa monnieri, a traditional Ayurvedic herb known for its cognitive-enhancing and neuroprotective properties. Bacoside A is a mixture of saponins, which are believed to support brain function by improving synaptic transmission and enhancing the repair of damaged neurons. It has been studied for its potential to improve memory, learning, and focus, making it a popular ingredient in nootropic supplements. Additionally, Bacoside A exhibits antioxidant and anti-inflammatory effects, which may contribute to its neuroprotective abilities, potentially aiding in the treatment of cognitive decline and neurodegenerative disorders.
| Catalog Number | M058341 |
| CAS Number | 11028-00-5 |
| Synonyms | Gynostemma Pentaphyllum P.E. Gypenoside; Dammar-24-en-16-one, 3-((alpha-L-arabinopyranosyl-O-beta-D-glucopyranosyl)oxy)-19,20-dihydroxy-. |
| Molecular Formula | C41H68O13 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at -20°C |
| Overview of Clinical Research | Originator: Central Drug Research Institute<br /> |
| IUPAC Name | (5R,8R,9S,10S,13R,14R,17S)-3-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-10-(hydroxymethyl)-17-[(2S)-2-hydroxy-6-methylhept-5-en-2-yl]-4,4,8,14-tetramethyl-1,2,3,5,6,7,9,11,12,13,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| InChI | InChI=1S/C41H68O13/c1-21(2)9-8-14-40(7,50)29-22-10-11-27-38(5,39(22,6)17-23(29)44)15-12-26-37(3,4)28(13-16-41(26,27)20-43)53-36-33(49)31(47)34(25(18-42)52-36)54-35-32(48)30(46)24(45)19-51-35/h9,22,24-36,42-43,45-50H,8,10-20H2,1-7H3/t22-,24+,25-,26+,27+,28?,29-,30+,31-,32-,33-,34-,35+,36+,38-,39-,40+,41-/m1/s1 |
| InChIKey | LKCTWIIDXXXXAR-CYGHALRTSA-N |
| SMILES | CC(=CCCC(C)(C1C2CCC3C(C2(CC1=O)C)(CCC4C3(CCC(C4(C)C)OC5C(C(C(C(O5)CO)OC6C(C(C(CO6)O)O)O)O)O)CO)C)O)C |
