For research use only. Not for therapeutic Use.
Bafetinib（Cat No.:I005159）is a second-generation tyrosine kinase inhibitor (TKI) that selectively targets BCR-ABL and Lyn kinases, both of which play crucial roles in the progression of chronic myeloid leukemia (CML) and acute lymphoblastic leukemia (ALL). Bafetinib is particularly effective against BCR-ABL mutations that are resistant to first-generation TKIs like imatinib. Its inhibition of Lyn kinase also makes it valuable in studying diseases where aberrant Lyn signaling is implicated. Bafetinib offers a promising therapeutic option for patients with TKI-resistant CML and contributes to the development of more effective leukemia treatments.
| Catalog Number | I005159 |
| CAS Number | 859212-16-1 |
| Synonyms | INNO-406;NS-187 |
| Molecular Formula | C₃₀H₃₁F₃N₈O |
| Purity | ≥95% |
| Target | Bcr-Abl/Lyn |
| Solubility | DMSO: ≥ 42 mg/mL |
| Storage | 3 years -20℃ powder |
| IC50 | 5.8 nM/19 nM |
| IUPAC Name | 4-[[(3S)-3-(dimethylamino)pyrrolidin-1-yl]methyl]-N-[4-methyl-3-[(4-pyrimidin-5-ylpyrimidin-2-yl)amino]phenyl]-3-(trifluoromethyl)benzamide |
| InChI | InChI=1S/C30H31F3N8O/c1-19-4-7-23(13-27(19)39-29-36-10-8-26(38-29)22-14-34-18-35-15-22)37-28(42)20-5-6-21(25(12-20)30(31,32)33)16-41-11-9-24(17-41)40(2)3/h4-8,10,12-15,18,24H,9,11,16-17H2,1-3H3,(H,37,42)(H,36,38,39)/t24-/m0/s1 |
| InChIKey | ZGBAJMQHJDFTQJ-DEOSSOPVSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=C(C=C2)CN3CC[C@@H](C3)N(C)C)C(F)(F)F)NC4=NC=CC(=N4)C5=CN=CN=C5 |
| Reference | <p style=/line-height:25px/> |
