For research use only. Not for therapeutic Use.
Baicalein（Cat No.:R036228）is a bioactive flavonoid derived from Scutellaria baicalensis (Chinese skullcap) and is widely recognized for its anti-inflammatory, antioxidant, and anticancer properties. This compound modulates various signaling pathways, including NF-κB and MAPK, making it valuable in research on chronic inflammatory diseases and immune responses. Baicalein also shows promise in neuroprotection, with studies indicating potential benefits for neurodegenerative conditions like Alzheimer’s disease. Its broad therapeutic potential extends to cardiovascular health and anti-viral applications, positioning Baicalein as a focal point in natural compound-based drug development and integrative medicine.
| Catalog Number | R036228 |
| CAS Number | 491-67-8 |
| Synonyms | 5,6,7-trihydroxyflavone |
| Molecular Formula | C15H10O5 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | 3 years -20C powder |
| IUPAC Name | 5,6,7-trihydroxy-2-phenylchromen-4-one |
| InChI | InChI=1S/C15H10O5/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12/h1-7,17-19H |
| InChIKey | FXNFHKRTJBSTCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)O)O |
