For research use only. Not for therapeutic Use.
Balovaptan(Cat No.:I003933) is a vasopressin receptor antagonist that acts on the V1a and V2 receptors. As a selective antagonist, it inhibits the binding of the hormone vasopressin to these receptors. By blocking the effects of vasopressin, balovaptan has the potential to modulate various physiological processes regulated by vasopressin, including water reabsorption, vasoconstriction, and social behavior. Balovaptan has been studied as a potential therapeutic agent for conditions such as autism spectrum disorder and urinary dysfunction.
CAS Number | 1228088-30-9 |
Synonyms | Balovaptan;8-chloro-5-methyl-1-{trans-4-[(pyridin-2-yl)oxy]cyclohexyl}-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
Molecular Formula | C22H24ClN5O |
Purity | ≥95% |
Target | Vasopressin Receptor |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 8-chloro-5-methyl-1-(4-pyridin-2-yloxycyclohexyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
InChI | InChI=1S/C22H24ClN5O/c1-27-13-16-12-17(23)7-10-19(16)28-20(14-27)25-26-22(28)15-5-8-18(9-6-15)29-21-4-2-3-11-24-21/h2-4,7,10-12,15,18H,5-6,8-9,13-14H2,1H3 |
InChIKey | GMPZPHGHNDMRKL-UHFFFAOYSA-N |
SMILES | CN1CC2=C(C=CC(=C2)Cl)N3C(=NN=C3C4CCC(CC4)OC5=CC=CC=N5)C1 |