For research use only. Not for therapeutic Use.
Baloxavir-d4 (Baloxavir acid-d4; S-033447-d4) is the deuterium-labeled Baloxavir (HY-109025A). Baloxavir-d4 (Baloxavir-d4 acid), derived from the proagent Baloxavir-d4 marboxil, is a first-in-class, potent and selective cap-dependent endonuclease (CEN) inhibitor within the polymerase PA subunit of influenza A and B viruses. Baloxavir-d4 inhibits viral RNA transcription and replication and has potently antiviral activity[1][2].
| Catalog Number | I040346 |
| CAS Number | 2415027-80-2 |
| Synonyms | (3R)-6,6,7,7-tetradeuterio-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| Molecular Formula | C24H15D4F2N3O4S |
| Purity | ≥95% |
| InChI | InChI=1S/C24H19F2N3O4S/c25-16-6-5-13-15(20(16)26)12-34-18-4-2-1-3-14(18)21(13)29-19-11-33-10-9-27(19)24(32)22-23(31)17(30)7-8-28(22)29/h1-8,19,21,31H,9-12H2/t19-,21+/m1/s1/i9D2,10D2 |
| InChIKey | FIDLLEYNNRGVFR-KZRIHOBTSA-N |
| SMILES | C1COCC2N1C(=O)C3=C(C(=O)C=CN3N2C4C5=C(CSC6=CC=CC=C46)C(=C(C=C5)F)F)O |
