For research use only. Not for therapeutic Use.
Baloxavir（Cat No.:I001654）is an antiviral medication used to treat acute, uncomplicated influenza infections. It works by inhibiting the cap-dependent endonuclease enzyme, essential for viral mRNA synthesis, effectively blocking the virus’s ability to replicate within host cells. Baloxavir is particularly effective when administered within 48 hours of symptom onset, helping to reduce symptom duration and viral spread. Unlike other antivirals, it is given as a single-dose treatment, enhancing patient compliance. Its unique mechanism and efficacy make it a valuable option for managing influenza outbreaks, including those involving drug-resistant strains.
| Catalog Number | I001654 |
| CAS Number | 1985605-59-1 |
| Synonyms | Baloxavir;Baloxavir |
| Molecular Formula | C24H19F2N3O4S |
| Purity | ≥95% |
| Target | Influenza Virus |
| Related CAS | 1985606-14-1 |
| IUPAC Name | (3R)-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| InChI | InChI=1S/C24H19F2N3O4S/c25-16-6-5-13-15(20(16)26)12-34-18-4-2-1-3-14(18)21(13)29-19-11-33-10-9-27(19)24(32)22-23(31)17(30)7-8-28(22)29/h1-8,19,21,31H,9-12H2/t19-,21+/m1/s1 |
| InChIKey | FIDLLEYNNRGVFR-CTNGQTDRSA-N |
| SMILES | C1COC[C@@H]2N1C(=O)C3=C(C(=O)C=CN3N2[C@H]4C5=C(CSC6=CC=CC=C46)C(=C(C=C5)F)F)O |
