Baohuoside I (Cat No.:I000512) is a natural flavonol glycoside compound extracted from Epimedium sagittatum. It exhibits pharmacological actions such as osteoprotective effects, promoting bone formation, and inhibiting bone resorption, making it potentially useful in the treatment of osteoporosis and related conditions. Additionally, baohuoside I has been studied for its aphrodisiac properties, suggesting potential applications in enhancing sexual function and libido. Further research is ongoing to elucidate its specific targets and mechanisms of action, as well as explore its potential therapeutic uses in drug development and other relevant areas.
| Catalog Number | I000512 |
| CAS Number | 113558-15-9 |
| Synonyms | Icariside-II |
| Molecular Formula | C27H30O10 |
| Purity | ≥95% |
| Target | CXCR4 |
| Solubility | DMSO:32 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
| InChI | InChI=1S/C27H30O10/c1-12(2)5-10-16-17(28)11-18(29)19-21(31)26(37-27-23(33)22(32)20(30)13(3)35-27)24(36-25(16)19)14-6-8-15(34-4)9-7-14/h5-9,11,13,20,22-23,27-30,32-33H,10H2,1-4H3/t13-,20-,22+,23+,27-/m0/s1 |
| InChIKey | NGMYNFJANBHLKA-LVKFHIPRSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=C(C(=CC(=C3C2=O)O)O)CC=C(C)C)C4=CC=C(C=C4)OC)O)O)O |
| Reference | <p> |
