For research use only. Not for therapeutic Use.
BAPTA tetrasodium(Cat No.:R071961)is a calcium chelator commonly used in biochemical and cell biology research to control and study intracellular calcium levels. It binds to free calcium ions (Ca²⁺) with high specificity, preventing calcium from influencing cellular processes, such as signal transduction, muscle contraction, and neurotransmitter release. BAPTA tetrasodium is often used in experiments that require the manipulation of calcium signaling, such as in studying ion channels, calcium-dependent enzymes, and neurotransmitter release. Its ability to effectively buffer calcium makes it valuable in studying cellular processes that are sensitive to calcium fluctuations.
CAS Number | 126824-24-6 |
Synonyms | tetrasodium;2-[2-[2-[2-[bis(carboxylatomethyl)amino]phenoxy]ethoxy]-N-(carboxylatomethyl)anilino]acetate |
Molecular Formula | C22H20N2Na4O10 |
Purity | ≥95% |
IUPAC Name | tetrasodium;2-[2-[2-[2-[bis(carboxylatomethyl)amino]phenoxy]ethoxy]-N-(carboxylatomethyl)anilino]acetate |
InChI | InChI=1S/C22H24N2O10.4Na/c25-19(26)11-23(12-20(27)28)15-5-1-3-7-17(15)33-9-10-34-18-8-4-2-6-16(18)24(13-21(29)30)14-22(31)32;;;;/h1-8H,9-14H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32);;;;/q;4*+1/p-4 |
InChIKey | ZWSMLJACYSGFKD-UHFFFAOYSA-J |
SMILES | C1=CC=C(C(=C1)N(CC(=O)[O-])CC(=O)[O-])OCCOC2=CC=CC=C2N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |