For research use only. Not for therapeutic Use.
Baquiloprim(Cat No.:R061088)is a potent dihydrofolate reductase (DHFR) inhibitor, primarily used in veterinary medicine. It acts by interfering with bacterial folate synthesis, an essential pathway for DNA replication and cell division. Baquiloprim exhibits broad-spectrum antibacterial activity, particularly against Gram-positive and some Gram-negative bacteria, making it effective in treating infections in livestock. Often used in combination with sulfonamides for synergistic effects, it enhances therapeutic efficacy while minimizing resistance development. Baquiloprim plays a significant role in veterinary antibiotic therapies, supporting animal health and productivity in agricultural settings.
CAS Number | 102280-35-3 |
Synonyms | 138OU; 5-[[8-(Dimethylamino)-7-methyl-5-quinolinyl]methyl]-2,4-pyrimidinediamine |
Molecular Formula | C17H20N6 |
Purity | ≥95% |
Target | Antibiotic |
Storage | -20°C |
IUPAC Name | 5-[[8-(dimethylamino)-7-methylquinolin-5-yl]methyl]pyrimidine-2,4-diamine |
InChI | InChI=1S/C17H20N6/c1-10-7-11(8-12-9-21-17(19)22-16(12)18)13-5-4-6-20-14(13)15(10)23(2)3/h4-7,9H,8H2,1-3H3,(H4,18,19,21,22) |
InChIKey | AIOWJIMWVFWROP-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C=CC=NC2=C1N(C)C)CC3=CN=C(N=C3N)N |