For research use only. Not for therapeutic Use.
Basroparib（Cat No.:I043420）is a potent and selective inhibitor of poly (ADP-ribose) polymerase (PARP), a protein involved in DNA repair. By inhibiting PARP, Basroparib prevents the repair of DNA damage, leading to cell death, particularly in cancer cells with compromised DNA repair mechanisms. It has shown promise in treating cancers such as ovarian, breast, and prostate cancers, especially in patients with BRCA1 or BRCA2 mutations. As a targeted therapy, Basroparib enhances the effectiveness of chemotherapy and radiation treatments, making it a valuable tool in oncology for personalized cancer therapies.
| CAS Number | 1858179-75-5 |
| Synonyms | 5-[4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-3-methyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| Molecular Formula | C18H21F2N7O3 |
| Purity | ≥95% |
| IUPAC Name | 5-[4-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]-3-methyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| InChI | InChI=1S/C18H21F2N7O3/c1-25-16-14(23-24-25)17(28)22-18(21-16)27-5-3-26(4-6-27)15-12(19)9-11(10-13(15)20)30-8-7-29-2/h9-10H,3-8H2,1-2H3,(H,21,22,28) |
| InChIKey | ALDDPEMJJONRDI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC(=N2)N3CCN(CC3)C4=C(C=C(C=C4F)OCCOC)F)N=N1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
