For research use only. Not for therapeutic Use.
The Bax channel blocker (CAT: I011471) is a small molecule inhibitor that targets the Bax protein, which plays a critical role in regulating programmed cell death (apoptosis). Bax is a pro-apoptotic protein that promotes the release of cytochrome c from mitochondria, leading to cell death. The Bax channel blocker works by binding to the Bax protein and inhibiting its ability to form channels in the mitochondrial membrane, thereby preventing cytochrome c release and reducing cell death. This compound has potential therapeutic applications in the treatment of diseases associated with abnormal cell death, such as cancer and neurodegenerative disorders. However, further research is needed to fully understand the pharmacological effects and potential clinical applications of the Bax channel blocker.
CAS Number | 335165-68-9 |
Synonyms | 1-(3,6-dibromocarbazol-9-yl)-3-piperazin-1-ylpropan-2-ol;dihydrochloride |
Molecular Formula | C19H23Br2Cl2N3O |
Purity | ≥95% |
Target | Bcl-2 Family |
Solubility | Soluble in DMSO > 10 mM |
Storage | Desiccate at RT |
IUPAC Name | 1-(3,6-dibromocarbazol-9-yl)-3-piperazin-1-ylpropan-2-ol;dihydrochloride |
InChI | InChI=1S/C19H21Br2N3O.2ClH/c20-13-1-3-18-16(9-13)17-10-14(21)2-4-19(17)24(18)12-15(25)11-23-7-5-22-6-8-23;;/h1-4,9-10,15,22,25H,5-8,11-12H2;2*1H |
InChIKey | HWFKCAFKXZFOQT-UHFFFAOYSA-N |
SMILES | C1CN(CCN1)CC(CN2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br)O.Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |