For research use only. Not for therapeutic Use.
BAY-069（Cat No.:I042753）is an investigational compound being developed for its potential in treating various cancers and inflammatory conditions. It works by targeting specific pathways involved in cell growth, immune regulation, and tumor progression. BAY-069 has demonstrated promising preclinical results, including the inhibition of cancer cell proliferation and the modulation of immune responses. Researchers are studying its mechanism of action, safety profile, and efficacy in clinical trials, aiming to determine its potential as a targeted therapy for difficult-to-treat cancers and inflammatory diseases. Further studies are ongoing to explore its therapeutic applications.
| CAS Number | 2639638-66-5 |
| Synonyms | 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| Molecular Formula | C22H14ClF3N2O3 |
| Purity | ≥95% |
| IUPAC Name | 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C22H14ClF3N2O3/c1-12-6-2-5-9-16(12)31-17-10-15(13-7-3-4-8-14(13)20(17)23)28-19(29)11-18(22(24,25)26)27-21(28)30/h2-11H,1H3,(H,27,30) |
| InChIKey | UNSHMXUHOHBLIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=C(C3=CC=CC=C3C(=C2)N4C(=O)C=C(NC4=O)C(F)(F)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
