For research use only. Not for therapeutic Use.
BAY1251152（Cat No.:I001986） is a highly potent inhibitor of PTEFb/CDK9, a key regulator of gene transcription. It demonstrates an IC50 value of 3 nM for CDK9 in enzymatic assays, exhibiting significant selectivity for CDK9 over other CDKs. By binding to CDK9, BAY1251152 effectively inhibits its phosphorylation and kinase activity. This leads to the suppression of PTEFb-mediated activation of RNA polymerase II (RNAPolII) and subsequent repression of gene transcription, particularly genes encoding anti-apoptotic proteins. BAY1251152 holds promise as a potential therapeutic agent for diseases characterized by dysregulated gene expression and enhanced cell survival.
| Catalog Number | I001986 |
| CAS Number | 1610358-56-9 |
| Synonyms | BAY-1251152; BAY 1251152; BAY1251152; (+)-BAY-1251152. |
| Molecular Formula | C19H18F2N4O2S |
| Purity | ≥95% |
| Target | CDK9 |
| IUPAC Name | (+)-5-Fluoro-4-(4-fluoro-2-methoxyphenyl)-N-[4-[(S-methylsulfonimidoyl)methyl]pyridin-2-yl]pyridin-2-amine |
| InChI | InChI=1S/C19H18F2N4O2S/c1-27-17-8-13(20)3-4-14(17)15-9-19(24-10-16(15)21)25-18-7-12(5-6-23-18)11-28(2,22)26/h3-10,22H,11H2,1-2H3,(H,23,24,25) |
| InChIKey | YZCUMZWULWOUMD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)F)C2=CC(=NC=C2F)NC3=NC=CC(=C3)CS(=N)(=O)C |
