For research use only. Not for therapeutic Use.
BAY 2416964 is a potent and orally active aryl hydrocarbon receptor (AHR) antagonist extracted from patent WO2018146010A1, example 192, has an IC50 of 341 nM. BAY 2416964 has the potential for solid tumors treatment[1].
BAY 2416964 (Example 192) induces AHR-regulated gene CYP1A1 expression in a human monocytic U937 cells with an IC50 of 4.3 nM[1].
| Catalog Number | I016822 |
| CAS Number | 2242464-44-2 |
| Synonyms | 6-(4-chlorophenyl)-N-[(2S)-1-hydroxypropan-2-yl]-2-(1-methylpyrazol-4-yl)-3-oxopyridazine-4-carboxamide |
| Molecular Formula | C18H18ClN5O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H18ClN5O3/c1-11(10-25)21-17(26)15-7-16(12-3-5-13(19)6-4-12)22-24(18(15)27)14-8-20-23(2)9-14/h3-9,11,25H,10H2,1-2H3,(H,21,26)/t11-/m0/s1 |
| InChIKey | YAGSZKAJPHGVOV-NSHDSACASA-N |
| SMILES | CC(CO)NC(=O)C1=CC(=NN(C1=O)C2=CN(N=C2)C)C3=CC=C(C=C3)Cl |
| Reference | [1]. Ilona GUTCHER, et al. 2-heteroaryl-3-oxo-2,3-dihydropyridazine-4-carboxamides for the treatment of cancer. WO2018146010A1 |
