For research use only. Not for therapeutic Use.
BAY-320(CAT: I003984) is a specific inhibitor of Bub1 kinase. Bub1 kinase is a key component of the mitotic checkpoint, which ensures accurate chromosome segregation during cell division. By inhibiting Bub1 kinase activity, BAY-320 disrupts the proper functioning of the mitotic checkpoint and impairs cell division. This inhibition can lead to abnormal chromosome segregation and cell death in rapidly dividing cells, such as cancer cells. BAY-320 shows potential as a targeted therapy for the treatment of various types of cancer, where dysregulated cell division is a hallmark feature.
| Catalog Number | I003984 |
| CAS Number | 1445830-50-1 |
| Synonyms | BAY-320; BAY 320; BAY320.;2-[5-cyclopropyl-1-[(4-ethoxy-2,6-difluorophenyl)methyl]-4-methylpyrazol-3-yl]-5-methoxy-N-pyridin-4-ylpyrimidin-4-amine |
| Molecular Formula | C26H26F2N6O2 |
| Purity | ≥95% |
| Target | Bub1 kinase inhibitor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| InChI | InChI=1S/C26H26F2N6O2/c1-4-36-18-11-20(27)19(21(28)12-18)14-34-24(16-5-6-16)15(2)23(33-34)26-30-13-22(35-3)25(32-26)31-17-7-9-29-10-8-17/h7-13,16H,4-6,14H2,1-3H3,(H,29,30,31,32) |
| InChIKey | WAELFQHBZPHEMW-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(C2=NN(CC3=C(F)C=C(OCC)C=C3F)C(C4CC4)=C2C)N=C1NC5=CC=NC=C5 |
| Reference | 1: Baron AP, von Schubert C, Cubizolles F, Siemeister G, Hitchcock M, Mengel A, |
