For research use only. Not for therapeutic Use.
BAY-390（Cat No.:I042641）is an investigational compound being studied for its potential in treating various cancers and inflammatory diseases. It is designed to selectively target specific proteins or enzymes involved in the regulation of cell growth, survival, and immune responses. By inhibiting these pathways, BAY-390 aims to disrupt tumor progression and modulate the immune system. Early preclinical studies have shown promising results, suggesting that BAY-390 may be effective in reducing tumor growth and enhancing the effects of other cancer therapies. Ongoing clinical trials are assessing its safety, efficacy, and therapeutic potential.
| CAS Number | 2741956-55-6 |
| Synonyms | (1R,2R)-2-(4-fluoroanilino)-1-(trifluoromethyl)cyclohexan-1-ol |
| Molecular Formula | C13H15F4NO |
| Purity | ≥95% |
| IUPAC Name | (1R,2R)-2-(4-fluoroanilino)-1-(trifluoromethyl)cyclohexan-1-ol |
| InChI | InChI=1S/C13H15F4NO/c14-9-4-6-10(7-5-9)18-11-3-1-2-8-12(11,19)13(15,16)17/h4-7,11,18-19H,1-3,8H2/t11-,12-/m1/s1 |
| InChIKey | IESAJAZKMLPVIB-VXGBXAGGSA-N |
| SMILES | C1CC[C@@]([C@@H](C1)NC2=CC=C(C=C2)F)(C(F)(F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
