For research use only, not for therapeutic use.
BAY 43-9006 (also known as Sorafenib)（Cat No.:A000517）is a multikinase inhibitor that targets several tyrosine and serine/threonine kinases, including RAF kinase, VEGFR, PDGFR, and KIT. It is primarily used in cancer research and treatment, particularly for advanced renal cell carcinoma, hepatocellular carcinoma, and thyroid cancer. By inhibiting these kinases, BAY 43-9006 disrupts tumor cell proliferation and angiogenesis, thereby reducing tumor growth. Its ability to target multiple signaling pathways makes it a versatile and valuable compound for exploring therapeutic strategies in oncology.
| Catalog Number | A000517 |
| CAS Number | 475207-59-1 |
| Synonyms | Bay 43-9006 |
| Molecular Formula | C₂₁H₁₆ClF₃N₄O₃.C₇H₈O₃S |
| Purity | ≥95% |
| Target | PDGFR |
| Solubility | >31.9mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide;4-methylbenzenesulfonic acid |
| InChI | InChI=1S/C21H16ClF3N4O3.C7H8O3S/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25;1-6-2-4-7(5-3-6)11(8,9)10/h2-11H,1H3,(H,26,30)(H2,28,29,31);2-5H,1H3,(H,8,9,10) |
| InChIKey | IVDHYUQIDRJSTI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |
