For research use only. Not for therapeutic Use.
BAY 43-9006 Free base（Cat No.:A000154）is a multikinase inhibitor that targets several key enzymes involved in tumor growth and angiogenesis, including RAF kinase, VEGFR, and PDGFR. By inhibiting these kinases, Sorafenib disrupts tumor cell proliferation and angiogenesis, leading to reduced tumor growth and metastasis. It has been approved for the treatment of various cancers, including advanced renal cell carcinoma, hepatocellular carcinoma, and thyroid cancer. Sorafenib is widely used in oncology research to study its effects on signaling pathways related to tumor development, making it a significant agent in targeted cancer therapy.
| Catalog Number | A000154 |
| CAS Number | 284461-73-0 |
| Synonyms | BAY 43-9006 |
| Molecular Formula | C₂₁H₁₆ClF₃N₄O₃ |
| Purity | ≥95% |
| Target | PDGFR |
| Solubility | >23.3mg/mL in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |
| InChI | InChI=1S/C21H16ClF3N4O3/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31) |
| InChIKey | MLDQJTXFUGDVEO-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |
