For research use only. Not for therapeutic Use.
BAY-4931（Cat No.:I042621）is an investigational compound being developed for its potential use in treating cancer and autoimmune diseases. It functions by targeting specific molecules or signaling pathways that regulate immune responses, inflammation, and tumor growth. BAY-4931 is designed to modulate immune cell activity, enhance anti-tumor immune responses, and inhibit the progression of cancer. Early preclinical studies have shown promising results in inhibiting tumor growth and improving immune system activation. Ongoing research and clinical trials are focused on assessing its safety, efficacy, and potential as a novel therapeutic option in cancer immunotherapy.
| CAS Number | 423150-91-8 |
| Synonyms | 2-chloro-N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]-5-nitrobenzamide |
| Molecular Formula | C22H16ClN3O4 |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-N-[2-(4-ethylphenyl)-1,3-benzoxazol-5-yl]-5-nitrobenzamide |
| InChI | InChI=1S/C22H16ClN3O4/c1-2-13-3-5-14(6-4-13)22-25-19-11-15(7-10-20(19)30-22)24-21(27)17-12-16(26(28)29)8-9-18(17)23/h3-12H,2H2,1H3,(H,24,27) |
| InChIKey | WFEBALYYDASKIV-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)NC(=O)C4=C(C=CC(=C4)[N+](=O)[O-])Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
