For research use only. Not for therapeutic Use.
BAY-5000（Cat No.:I042316）is a small molecule inhibitor developed by Bayer, primarily targeting the protein kinase B (Akt) pathway, which plays a critical role in cell survival, growth, and metabolism. It functions by selectively inhibiting Akt activity, a key player in many cancer types, making it a promising candidate for cancer therapy. Preclinical studies suggest BAY-5000 may enhance the effectiveness of other treatments, particularly in cancers resistant to conventional therapies. By blocking Akt signaling, BAY-5000 aims to induce tumor cell apoptosis, reduce growth, and improve overall treatment outcomes in oncology.
| Catalog Number | I042316 |
| CAS Number | 2639435-48-4 |
| Synonyms | 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| Molecular Formula | C22H14ClF3N2O3 |
| Purity | ≥95% |
| IUPAC Name | 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C22H14ClF3N2O3/c1-12-6-2-5-9-16(12)31-17-10-15(13-7-3-4-8-14(13)20(17)23)28-19(29)11-18(22(24,25)26)27-21(28)30/h2-11H,1H3,(H,27,30) |
| InChIKey | UNSHMXUHOHBLIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=C(C3=CC=CC=C3C(=C2)N4C(=O)C=C(NC4=O)C(F)(F)F)Cl |
