For research use only. Not for therapeutic Use.
BAY-5000 (example 32) is a pyrimidinedione derivative. BAY-5000 can be used in the synthesis of cancer-related reagents[1].
| Catalog Number | I042316 |
| CAS Number | 2639435-48-4 |
| Synonyms | 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| Molecular Formula | C22H14ClF3N2O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H14ClF3N2O3/c1-12-6-2-5-9-16(12)31-17-10-15(13-7-3-4-8-14(13)20(17)23)28-19(29)11-18(22(24,25)26)27-21(28)30/h2-11H,1H3,(H,27,30) |
| InChIKey | UNSHMXUHOHBLIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=C(C3=CC=CC=C3C(=C2)N4C(=O)C=C(NC4=O)C(F)(F)F)Cl |
| Reference | [1]. Bouche Lea Aurelie, et al. Pyrimidinedione derivatives: World Intellectual Property Organization, WO2021063821[P].2021-04-08. |
