BAY 57-1293 (CAT: I003273) is a potent inhibitor of the human herpes simplex virus (HSV) DNA polymerase. It specifically targets the viral DNA polymerase, preventing the replication of the viral DNA. BAY 57-1293 has shown antiviral activity against both HSV-1 and HSV-2 strains and is considered a promising candidate for the treatment of HSV infections. Its inhibitory effect on viral DNA polymerase makes it a valuable tool in research related to HSV replication and the development of antiviral therapies.
| Catalog Number | I003273 |
| CAS Number | 348086-71-5 |
| Synonyms | N-methyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide |
| Molecular Formula | C₁₈H₁₈N₄O₃S₂ |
| Purity | 98% |
| Target | HSV |
| Solubility | DMSO: ≥ 33 mg/mL |
| Storage | Store at -20°C |
| IC50 | 20 nM (HSV-1) |
| InChI | InChI=1S/C18H18N4O3S2/c1-12-17(27(19,24)25)26-18(21-12)22(2)16(23)11-13-6-8-14(9-7-13)15-5-3-4-10-20-15/h3-10H,11H2,1-2H3,(H2,19,24,25) |
| InChIKey | IVZKZONQVYTCKC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N(C)C(=O)CC2=CC=C(C=C2)C3=CC=CC=N3)S(=O)(=O)N |
| Documentation | CoA |
