For research use only. Not for therapeutic Use.
Bay 65-1942 hydrochloride (Cat.No:I004255) is a selective inhibitor of the TRPV4 ion channel, which is involved in various physiological and pathological processes such as osmoregulation, inflammation, and pain perception. It has potential applications in the treatment of diseases such as osteoarthritis, neuropathic pain, and respiratory disorders.
| Catalog Number | I004255 |
| CAS Number | 600734-06-3 |
| Synonyms | (7E)-7-[2-(cyclopropylmethoxy)-6-oxocyclohexa-2,4-dien-1-ylidene]-5-[(3S)-piperidin-3-yl]-4,8-dihydro-1H-pyrido[2,3-d][1,3]oxazin-2-one;hydrochloride |
| Molecular Formula | C22H26ClN3O4 |
| Purity | ≥95% |
| Target | IKK |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (7E)-7-[2-(cyclopropylmethoxy)-6-oxocyclohexa-2,4-dien-1-ylidene]-5-[(3S)-piperidin-3-yl]-4,8-dihydro-1H-pyrido[2,3-d][1,3]oxazin-2-one;hydrochloride |
| InChI | InChI=1S/C22H25N3O4.ClH/c26-18-4-1-5-19(28-11-13-6-7-13)20(18)17-9-15(14-3-2-8-23-10-14)16-12-29-22(27)25-21(16)24-17;/h1,4-5,9,13-14,23-24H,2-3,6-8,10-12H2,(H,25,27);1H/b20-17-;/t14-;/m1./s1 |
| InChIKey | KSTOJOVDFHFWCE-VHNKIRJFSA-N |
| SMILES | C1CC(CNC1)C2=CC(=C3C(=O)C=CC=C3OCC4CC4)NC5=C2COC(=O)N5.Cl |
| Reference | <p style=/line-height:25px/> |
