For research use only. Not for therapeutic Use.
BAY-805（Cat No.:I041407）is a selective inhibitor of the protein kinase CK2 (casein kinase 2), an enzyme that plays a key role in regulating various cellular processes, including cell survival, proliferation, and apoptosis. By inhibiting CK2, BAY-805 disrupts signaling pathways critical to tumor growth and survival, making it a promising candidate in cancer therapy, particularly for malignancies with dysregulated CK2 activity. Additionally, its ability to modulate cellular stress responses and influence immune cell function positions BAY-805 as a potential therapeutic in both cancer treatment and inflammation-related diseases.
| CAS Number | 2925481-88-3 |
| Synonyms | N-[(2R)-1-[[5-[(4-cyanophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-(trifluoromethyl)cyclohexane-1-carboxamide |
| Molecular Formula | C24H28F3N5O2S |
| Purity | ≥95% |
| IUPAC Name | N-[(2R)-1-[[5-[(4-cyanophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-1-(trifluoromethyl)cyclohexane-1-carboxamide |
| InChI | InChI=1S/C24H28F3N5O2S/c1-15(2)12-18(29-21(34)23(24(25,26)27)10-4-3-5-11-23)20(33)30-22-32-31-19(35-22)13-16-6-8-17(14-28)9-7-16/h6-9,15,18H,3-5,10-13H2,1-2H3,(H,29,34)(H,30,32,33)/t18-/m1/s1 |
| InChIKey | LXRBPWHQMGKMRT-GOSISDBHSA-N |
| SMILES | CC(C)C[C@H](C(=O)NC1=NN=C(S1)CC2=CC=C(C=C2)C#N)NC(=O)C3(CCCCC3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
