For research use only. Not for therapeutic Use.
BAY-888 exhibits IC50 value of 1.5 nM and 5.5 nM towards CSNK1A1 and CSNK1D, respectively.
| Catalog Number | I043842 |
| CAS Number | 2468783-75-5 |
| Synonyms | (2S)-N-[4-(3-anilino-5-methyl-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl)pyridin-2-yl]-2-(4-fluorophenyl)propanamide |
| Molecular Formula | C28H26FN5O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C28H26FN5O2/c1-17(18-8-10-20(29)11-9-18)27(35)33-23-16-19(12-14-30-23)25-26(31-21-6-4-3-5-7-21)24-22(32-25)13-15-34(2)28(24)36/h3-12,14,16-17,31-32H,13,15H2,1-2H3,(H,30,33,35)/t17-/m0/s1 |
| InChIKey | UYAQWCZWVIFRCN-KRWDZBQOSA-N |
| SMILES | CC(C1=CC=C(C=C1)F)C(=O)NC2=NC=CC(=C2)C3=C(C4=C(N3)CCN(C4=O)C)NC5=CC=CC=C5 |
| Reference | [1]. Volker Schulze, et al. Substituted pyrrolo-pyridinone derivatives and therapeutic uses thereof. WO2022023337 A1. |
