For research use only. Not for therapeutic Use.
BC-11 Hydrobromide(CAT: I010944) is a dual-action inhibitor targeting both TMPRSS2 and urokinase-type plasminogen activator (uPA), with an IC₅₀ of 8.2 μM for uPA. TMPRSS2 is a key host protease involved in viral entry, including SARS-CoV-2, making BC-11 a valuable tool in antiviral research. Additionally, its inhibition of uPA, a protease implicated in tumor invasion and metastasis, supports its application in cancer studies. BC-11 hydrobromide exhibits cytotoxicity against triple-negative MDA-MB231 breast cancer cells, highlighting its potential in oncology. This compound is widely used in research exploring viral pathogenesis and aggressive cancer phenotypes.
| CAS Number | 443776-49-6 |
| Synonyms | [4-(carbamimidoylsulfanylmethyl)phenyl]boronic acid;hydrobromide |
| Molecular Formula | C8H12BBrN2O2S |
| Purity | ≥95% |
| IUPAC Name | [4-(carbamimidoylsulfanylmethyl)phenyl]boronic acid;hydrobromide |
| InChI | InChI=1S/C8H11BN2O2S.BrH/c10-8(11)14-5-6-1-3-7(4-2-6)9(12)13;/h1-4,12-13H,5H2,(H3,10,11);1H |
| InChIKey | PAFZAMOVHIRQOD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CSC(=N)N)(O)O.Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
