For research use only. Not for therapeutic Use.
BC-1471（Cat No.:I023047）is an investigational small molecule compound being studied for its potential therapeutic applications, particularly in the treatment of cancer and other proliferative diseases. It is designed to inhibit specific enzymes or signaling pathways that contribute to tumor growth, metastasis, and resistance to cell death. By targeting these pathways, BC-1471 aims to slow down or stop the progression of cancer cells, potentially enhancing the effectiveness of other treatments. Ongoing research is focused on evaluating its efficacy, safety, and clinical benefits, with the goal of offering a new treatment option for patients with advanced or resistant cancers.
| CAS Number | 896683-84-4 |
| Synonyms | 2-[6-morpholin-4-yl-4-oxo-3-(2-phenylethyl)quinazolin-2-yl]sulfanyl-N-(oxolan-2-ylmethyl)acetamide |
| Molecular Formula | C27H32N4O4S |
| Purity | ≥95% |
| IUPAC Name | 2-[6-morpholin-4-yl-4-oxo-3-(2-phenylethyl)quinazolin-2-yl]sulfanyl-N-(oxolan-2-ylmethyl)acetamide |
| InChI | InChI=1S/C27H32N4O4S/c32-25(28-18-22-7-4-14-35-22)19-36-27-29-24-9-8-21(30-12-15-34-16-13-30)17-23(24)26(33)31(27)11-10-20-5-2-1-3-6-20/h1-3,5-6,8-9,17,22H,4,7,10-16,18-19H2,(H,28,32) |
| InChIKey | GJKRCJKXXVVAMV-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNC(=O)CSC2=NC3=C(C=C(C=C3)N4CCOCC4)C(=O)N2CCC5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
