For research use only. Not for therapeutic Use.
BC1618（Cat No.:I023049）is a selective and potent inhibitor of soluble epoxide hydrolase (sEH), an enzyme involved in the degradation of bioactive lipid epoxides that regulate inflammation and vascular function. By inhibiting sEH, BC1618 enhances the levels of beneficial epoxyeicosatrienoic acids (EETs), which have protective cardiovascular and anti-inflammatory effects. This compound is being studied for its potential in treating conditions such as hypertension, inflammation, and ischemic injury. BC1618’s unique mechanism of action makes it a promising candidate for exploring therapeutic interventions in cardiovascular and inflammatory diseases.
| Catalog Number | I023049 |
| CAS Number | 2222094-18-8 |
| Synonyms | BC1618; BC-1618; BC 1618; |
| Molecular Formula | C24H24F3NO2 |
| Purity | 98% |
| Target | PI3K/Akt/mTOR |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Store at -20°C |
| IUPAC Name | 1-(dibenzylamino)-3-[4-(trifluoromethyl)phenoxy]propan-2-ol |
| InChI | InChI=1S/C24H24F3NO2/c25-24(26,27)21-11-13-23(14-12-21)30-18-22(29)17-28(15-19-7-3-1-4-8-19)16-20-9-5-2-6-10-20/h1-14,22,29H,15-18H2 |
| InChIKey | LGTYABNNHILKHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)CC(COC3=CC=C(C=C3)C(F)(F)F)O |
| Reference | 1: Liu Y, Jurczak MJ, Lear TB, Lin B, Larsen MB, Kennerdell JR, Chen Y, Huckestein BR, Nguyen MK, Tuncer F, Jiang Y, Monga SP, O’Donnell CP, Finkel T, Chen BB, Mallampalli RK. A Fbxo48 inhibitor prevents pAMPKα degradation and ameliorates insulin resistance. Nat Chem Biol. 2021 Mar;17(3):298-306. doi: 10.1038/s41589-020-00723-0. Epub 2021 Jan 25. PMID: 33495648. |
